C9H10ClN5O3S2 — CID 106314716
4-chloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-sulfonamide (PubChem CID 106314716) has the molecular formula C9H10ClN5O3S2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 4-chloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-sulfonamide.
| Compound Name | 4-chloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106314716 |
| Molecular Formula | C9H10ClN5O3S2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 4-chloro-N-[4-(N-hydroxy-C-methylcarbonimidoyl)-1,3-thiazol-2-yl]-1-methylpyrazole-5-sulfonamide |
| SMILES | CC(=NO)c1csc(NS(=O)(=O)c2c(Cl)cnn2C)n1 |
| InChI | InChI=1S/C9H10ClN5O3S2/c1-5(13-16)7-4-19-9(12-7)14-20(17,18)8-6(10)3-11-15(8)2/h3-4,16H,1-2H3,(H,12,14) |
| InChIKey | FWADPYKCIQNRGM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|