C10H11ClN4O4S — CID 106314240
3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-methyl-1H-pyrrole-2-carboxylic acid (PubChem CID 106314240) has the molecular formula C10H11ClN4O4S and a molecular weight of 318.74 g/mol. Its IUPAC name is 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-methyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-methyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 106314240 |
| Molecular Formula | C10H11ClN4O4S |
| Molecular Weight | 318.74 g/mol |
| Exact Mass | 318.02 |
| IUPAC Name | 3-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]-5-methyl-1H-pyrrole-2-carboxylic acid |
| SMILES | Cc1cc(NS(=O)(=O)c2c(Cl)cnn2C)c(C(=O)O)[nH]1 |
| InChI | InChI=1S/C10H11ClN4O4S/c1-5-3-7(8(13-5)10(16)17)14-20(18,19)9-6(11)4-12-15(9)2/h3-4,13-14H,1-2H3,(H,16,17) |
| InChIKey | KKZSHAYDIWJBDW-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.74 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |