C10H10BrClN4O2S — CID 106313884
N-(5-amino-2-bromophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide (PubChem CID 106313884) has the molecular formula C10H10BrClN4O2S and a molecular weight of 365.64 g/mol. Its IUPAC name is N-(5-amino-2-bromophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide.
| Compound Name | N-(5-amino-2-bromophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106313884 |
| Molecular Formula | C10H10BrClN4O2S |
| Molecular Weight | 365.64 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | N-(5-amino-2-bromophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)Nc1cc(N)ccc1Br |
| InChI | InChI=1S/C10H10BrClN4O2S/c1-16-10(8(12)5-14-16)19(17,18)15-9-4-6(13)2-3-7(9)11/h2-5,15H,13H2,1H3 |
| InChIKey | MXWXUYJQPJJZPG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.64 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|