About N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide
N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide (PubChem CID 106313880) has the molecular formula C10H9ClF2N4O2S
and a molecular weight of 322.72 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide |
| PubChem CID | 106313880 |
| Molecular Formula | C10H9ClF2N4O2S |
| Molecular Weight | 322.72 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)Nc1c(N)cc(F)cc1F |
| InChI | InChI=1S/C10H9ClF2N4O2S/c1-17-10(6(11)4-15-17)20(18,19)16-9-7(13)2-5(12)3-8(9)14/h2-4,16H,14H2,1H3 |
| InChIKey | KPFCRMYFMLRPLQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide?
The IUPAC name of N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide (CID 106313880) is N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide.
What is the SMILES notation for N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide?
The canonical SMILES for N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide is Cn1ncc(Cl)c1S(=O)(=O)Nc1c(N)cc(F)cc1F.
What is the InChIKey of N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide?
The InChIKey is KPFCRMYFMLRPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClF2N4O2S/c1-17-10(6(11)4-15-17)20(18,19)16-9-7(13)2-5(12)3-8(9)14/h2-4,16H,14H2,1H3.
What are the key properties of N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide?
N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide has a molecular weight of 322.72 g/mol, XLogP of 1.73, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4,6-difluorophenyl)-4-chloro-1-methylpyrazole-5-sulfonamide is sourced from PubChem (CID 106313880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).