C10H9F2N3O2S2 — CID 103413990
N-(2-amino-4,6-difluorophenyl)-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103413990) has the molecular formula C10H9F2N3O2S2 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103413990 |
| Molecular Formula | C10H9F2N3O2S2 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)Nc2c(N)cc(F)cc2F)s1 |
| InChI | InChI=1S/C10H9F2N3O2S2/c1-5-14-4-9(18-5)19(16,17)15-10-7(12)2-6(11)3-8(10)13/h2-4,15H,13H2,1H3 |
| InChIKey | NORCCVZVTKSHGN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|