C10H7BrF2N2O2S2 — CID 81315432
N-(2-amino-4,6-difluorophenyl)-5-bromothiophene-2-sulfonamide (PubChem CID 81315432) has the molecular formula C10H7BrF2N2O2S2 and a molecular weight of 369.21 g/mol. Its IUPAC name is N-(2-amino-4,6-difluorophenyl)-5-bromothiophene-2-sulfonamide.
| Compound Name | N-(2-amino-4,6-difluorophenyl)-5-bromothiophene-2-sulfonamide |
|---|---|
| PubChem CID | 81315432 |
| Molecular Formula | C10H7BrF2N2O2S2 |
| Molecular Weight | 369.21 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | N-(2-amino-4,6-difluorophenyl)-5-bromothiophene-2-sulfonamide |
| SMILES | Nc1cc(F)cc(F)c1NS(=O)(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H7BrF2N2O2S2/c11-8-1-2-9(18-8)19(16,17)15-10-6(13)3-5(12)4-7(10)14/h1-4,15H,14H2 |
| InChIKey | KCOPFDWNFSASEX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.21 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|