C10H5Br2F2NO2S2 — CID 103844048
5-bromo-N-(4-bromo-2,5-difluorophenyl)thiophene-2-sulfonamide (PubChem CID 103844048) has the molecular formula C10H5Br2F2NO2S2 and a molecular weight of 433.09 g/mol. Its IUPAC name is 5-bromo-N-(4-bromo-2,5-difluorophenyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(4-bromo-2,5-difluorophenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103844048 |
| Molecular Formula | C10H5Br2F2NO2S2 |
| Molecular Weight | 433.09 g/mol |
| Exact Mass | 430.81 |
| IUPAC Name | 5-bromo-N-(4-bromo-2,5-difluorophenyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(Br)cc1F)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H5Br2F2NO2S2/c11-5-3-7(14)8(4-6(5)13)15-19(16,17)10-2-1-9(12)18-10/h1-4,15H |
| InChIKey | KCHPKGSBQUWQDC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|