C11H8BrF2NO2S2 — CID 6737105
5-bromo-N-[(2,4-difluorophenyl)methyl]thiophene-2-sulfonamide (PubChem CID 6737105) has the molecular formula C11H8BrF2NO2S2 and a molecular weight of 368.22 g/mol. Its IUPAC name is 5-bromo-N-[(2,4-difluorophenyl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[(2,4-difluorophenyl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6737105 |
| Molecular Formula | C11H8BrF2NO2S2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 5-bromo-N-[(2,4-difluorophenyl)methyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccc(F)cc1F)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H8BrF2NO2S2/c12-10-3-4-11(18-10)19(16,17)15-6-7-1-2-8(13)5-9(7)14/h1-5,15H,6H2 |
| InChIKey | LDKLIDXAQXGCAU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |