C8H7BrN2O3S2 — CID 103940604
5-bromo-N-(1,2-oxazol-5-ylmethyl)thiophene-2-sulfonamide (PubChem CID 103940604) has the molecular formula C8H7BrN2O3S2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 5-bromo-N-(1,2-oxazol-5-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(1,2-oxazol-5-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103940604 |
| Molecular Formula | C8H7BrN2O3S2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 321.91 |
| IUPAC Name | 5-bromo-N-(1,2-oxazol-5-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1ccno1)c1ccc(Br)s1 |
| InChI | InChI=1S/C8H7BrN2O3S2/c9-7-1-2-8(15-7)16(12,13)11-5-6-3-4-10-14-6/h1-4,11H,5H2 |
| InChIKey | UKBWZUSKVVZMLI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |