C12H10BrF2NO2S2 — CID 62305247
5-bromo-N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-sulfonamide (PubChem CID 62305247) has the molecular formula C12H10BrF2NO2S2 and a molecular weight of 382.25 g/mol. Its IUPAC name is 5-bromo-N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 62305247 |
| Molecular Formula | C12H10BrF2NO2S2 |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 380.93 |
| IUPAC Name | 5-bromo-N-[2-(3,5-difluorophenyl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCc1cc(F)cc(F)c1)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H10BrF2NO2S2/c13-11-1-2-12(19-11)20(17,18)16-4-3-8-5-9(14)7-10(15)6-8/h1-2,5-7,16H,3-4H2 |
| InChIKey | FXTXOQNDGUCECA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |