C11H13BrN2O2S2 — CID 110721147
5-bromo-N-(3-pyrrol-1-ylpropyl)thiophene-2-sulfonamide (PubChem CID 110721147) has the molecular formula C11H13BrN2O2S2 and a molecular weight of 349.28 g/mol. Its IUPAC name is 5-bromo-N-(3-pyrrol-1-ylpropyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(3-pyrrol-1-ylpropyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110721147 |
| Molecular Formula | C11H13BrN2O2S2 |
| Molecular Weight | 349.28 g/mol |
| Exact Mass | 347.96 |
| IUPAC Name | 5-bromo-N-(3-pyrrol-1-ylpropyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCCn1cccc1)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H13BrN2O2S2/c12-10-4-5-11(17-10)18(15,16)13-6-3-9-14-7-1-2-8-14/h1-2,4-5,7-8,13H,3,6,9H2 |
| InChIKey | UEKTYZWDEKQENJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|