C13H21BrN2O3S2 — CID 51330982
5-bromo-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]thiophene-2-sulfonamide (PubChem CID 51330982) has the molecular formula C13H21BrN2O3S2 and a molecular weight of 397.36 g/mol. Its IUPAC name is 5-bromo-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 51330982 |
| Molecular Formula | C13H21BrN2O3S2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 5-bromo-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]thiophene-2-sulfonamide |
| SMILES | CC1CN(CCCNS(=O)(=O)c2ccc(Br)s2)CC(C)O1 |
| InChI | InChI=1S/C13H21BrN2O3S2/c1-10-8-16(9-11(2)19-10)7-3-6-15-21(17,18)13-5-4-12(14)20-13/h4-5,10-11,15H,3,6-9H2,1-2H3 |
| InChIKey | UFANSEIFFDOMAP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|