C18H27BrN2O5S — CID 55573442
ethyl 3-bromo-4-[3-(2,6-dimethylmorpholin-4-yl)propylsulfamoyl]benzoate (PubChem CID 55573442) has the molecular formula C18H27BrN2O5S and a molecular weight of 463.39 g/mol. Its IUPAC name is ethyl 3-bromo-4-[3-(2,6-dimethylmorpholin-4-yl)propylsulfamoyl]benzoate.
| Compound Name | ethyl 3-bromo-4-[3-(2,6-dimethylmorpholin-4-yl)propylsulfamoyl]benzoate |
|---|---|
| PubChem CID | 55573442 |
| Molecular Formula | C18H27BrN2O5S |
| Molecular Weight | 463.39 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | ethyl 3-bromo-4-[3-(2,6-dimethylmorpholin-4-yl)propylsulfamoyl]benzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)NCCCN2CC(C)OC(C)C2)c(Br)c1 |
| InChI | InChI=1S/C18H27BrN2O5S/c1-4-25-18(22)15-6-7-17(16(19)10-15)27(23,24)20-8-5-9-21-11-13(2)26-14(3)12-21/h6-7,10,13-14,20H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | JCCOECUYEFCZFT-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|