C16H20BrNO6S — CID 55564850
methyl 1-(2-bromo-4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 55564850) has the molecular formula C16H20BrNO6S and a molecular weight of 434.31 g/mol. Its IUPAC name is methyl 1-(2-bromo-4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | methyl 1-(2-bromo-4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 55564850 |
| Molecular Formula | C16H20BrNO6S |
| Molecular Weight | 434.31 g/mol |
| Exact Mass | 433.02 |
| IUPAC Name | methyl 1-(2-bromo-4-ethoxycarbonylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CCC(C(=O)OC)CC2)c(Br)c1 |
| InChI | InChI=1S/C16H20BrNO6S/c1-3-24-16(20)12-4-5-14(13(17)10-12)25(21,22)18-8-6-11(7-9-18)15(19)23-2/h4-5,10-11H,3,6-9H2,1-2H3 |
| InChIKey | IBYBVGBICUIJMA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.31 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |