C13H18BrClN2O4S — CID 119959036
methyl 4-(4-aminopiperidin-1-yl)sulfonyl-3-bromobenzoate;hydrochloride (PubChem CID 119959036) has the molecular formula C13H18BrClN2O4S and a molecular weight of 413.72 g/mol. Its IUPAC name is methyl 4-(4-aminopiperidin-1-yl)sulfonyl-3-bromobenzoate;hydrochloride.
| Compound Name | methyl 4-(4-aminopiperidin-1-yl)sulfonyl-3-bromobenzoate;hydrochloride |
|---|---|
| PubChem CID | 119959036 |
| Molecular Formula | C13H18BrClN2O4S |
| Molecular Weight | 413.72 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | methyl 4-(4-aminopiperidin-1-yl)sulfonyl-3-bromobenzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(S(=O)(=O)N2CCC(N)CC2)c(Br)c1.Cl |
| InChI | InChI=1S/C13H17BrN2O4S.ClH/c1-20-13(17)9-2-3-12(11(14)8-9)21(18,19)16-6-4-10(15)5-7-16;/h2-3,8,10H,4-7,15H2,1H3;1H |
| InChIKey | NQBJKYMYMDIWEH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.72 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |