C13H20BrClN2O4S — CID 119959404
1-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119959404) has the molecular formula C13H20BrClN2O4S and a molecular weight of 415.74 g/mol. Its IUPAC name is 1-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119959404 |
| Molecular Formula | C13H20BrClN2O4S |
| Molecular Weight | 415.74 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | 1-(5-bromo-2,4-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | COc1cc(OC)c(S(=O)(=O)N2CCC(N)CC2)cc1Br.Cl |
| InChI | InChI=1S/C13H19BrN2O4S.ClH/c1-19-11-8-12(20-2)13(7-10(11)14)21(17,18)16-5-3-9(15)4-6-16;/h7-9H,3-6,15H2,1-2H3;1H |
| InChIKey | HTUDUGQJAPNYNE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.74 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |