C13H21ClN2O4S — CID 119959410
1-(3,5-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119959410) has the molecular formula C13H21ClN2O4S and a molecular weight of 336.84 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-(3,5-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119959410 |
| Molecular Formula | C13H21ClN2O4S |
| Molecular Weight | 336.84 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | COc1cc(OC)cc(S(=O)(=O)N2CCC(N)CC2)c1.Cl |
| InChI | InChI=1S/C13H20N2O4S.ClH/c1-18-11-7-12(19-2)9-13(8-11)20(16,17)15-5-3-10(14)4-6-15;/h7-10H,3-6,14H2,1-2H3;1H |
| InChIKey | GJSQDTOYCSXHPU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.84 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |