C16H24N2O4S — CID 138043275
2-(3,5-dimethoxyphenyl)sulfonyl-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine (PubChem CID 138043275) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)sulfonyl-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine.
| Compound Name | 2-(3,5-dimethoxyphenyl)sulfonyl-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 138043275 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)sulfonyl-5-methyl-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridine |
| SMILES | COc1cc(OC)cc(S(=O)(=O)N2CC3CCN(C)CC3C2)c1 |
| InChI | InChI=1S/C16H24N2O4S/c1-17-5-4-12-10-18(11-13(12)9-17)23(19,20)16-7-14(21-2)6-15(8-16)22-3/h6-8,12-13H,4-5,9-11H2,1-3H3 |
| InChIKey | PISMFHGZZZCIGM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |