C12H18BrClN2O3S — CID 119959359
1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride (PubChem CID 119959359) has the molecular formula C12H18BrClN2O3S and a molecular weight of 385.71 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 119959359 |
| Molecular Formula | C12H18BrClN2O3S |
| Molecular Weight | 385.71 g/mol |
| Exact Mass | 383.99 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-amine;hydrochloride |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(N)CC2)cc1Br.Cl |
| InChI | InChI=1S/C12H17BrN2O3S.ClH/c1-18-12-3-2-10(8-11(12)13)19(16,17)15-6-4-9(14)5-7-15;/h2-3,8-9H,4-7,14H2,1H3;1H |
| InChIKey | JYJOSSYNDDIYGM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.71 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |