C10H13BrCl2N2O2S — CID 120708379
1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 120708379) has the molecular formula C10H13BrCl2N2O2S and a molecular weight of 376.10 g/mol. Its IUPAC name is 1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | 1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 120708379 |
| Molecular Formula | C10H13BrCl2N2O2S |
| Molecular Weight | 376.10 g/mol |
| Exact Mass | 373.93 |
| IUPAC Name | 1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.NC1CCN(S(=O)(=O)c2ccc(Cl)c(Br)c2)C1 |
| InChI | InChI=1S/C10H12BrClN2O2S.ClH/c11-9-5-8(1-2-10(9)12)17(15,16)14-4-3-7(13)6-14;/h1-2,5,7H,3-4,6,13H2;1H |
| InChIKey | HCNRHOOXOQEZDJ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.10 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |