C10H10Br2ClNO2S — CID 106613066
3-bromo-1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidine (PubChem CID 106613066) has the molecular formula C10H10Br2ClNO2S and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-bromo-1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidine.
| Compound Name | 3-bromo-1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 106613066 |
| Molecular Formula | C10H10Br2ClNO2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 400.85 |
| IUPAC Name | 3-bromo-1-(3-bromo-4-chlorophenyl)sulfonylpyrrolidine |
| SMILES | O=S(=O)(c1ccc(Cl)c(Br)c1)N1CCC(Br)C1 |
| InChI | InChI=1S/C10H10Br2ClNO2S/c11-7-3-4-14(6-7)17(15,16)8-1-2-10(13)9(12)5-8/h1-2,5,7H,3-4,6H2 |
| InChIKey | GIOKGXMQCSWNSV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|