C10H14Cl2N2O2S — CID 119993468
(3S)-1-(3-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride (PubChem CID 119993468) has the molecular formula C10H14Cl2N2O2S and a molecular weight of 297.21 g/mol. Its IUPAC name is (3S)-1-(3-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride.
| Compound Name | (3S)-1-(3-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119993468 |
| Molecular Formula | C10H14Cl2N2O2S |
| Molecular Weight | 297.21 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | (3S)-1-(3-chlorophenyl)sulfonylpyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCN(S(=O)(=O)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C10H13ClN2O2S.ClH/c11-8-2-1-3-10(6-8)16(14,15)13-5-4-9(12)7-13;/h1-3,6,9H,4-5,7,12H2;1H/t9-;/m0./s1 |
| InChIKey | AGLQANZIADREOM-FVGYRXGTSA-N |
| XLogP | 1.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.21 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |