C12H16BrNO4S — CID 43502818
1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-ol (PubChem CID 43502818) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-ol.
| Compound Name | 1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-ol |
|---|---|
| PubChem CID | 43502818 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 1-(3-bromo-4-methoxyphenyl)sulfonylpiperidin-4-ol |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(O)CC2)cc1Br |
| InChI | InChI=1S/C12H16BrNO4S/c1-18-12-3-2-10(8-11(12)13)19(16,17)14-6-4-9(15)5-7-14/h2-3,8-9,15H,4-7H2,1H3 |
| InChIKey | VJUVOFQKAUGPTQ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |