C15H20BrNO5S — CID 95345944
(3R)-1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(1,3-dioxolan-2-yl)piperidine (PubChem CID 95345944) has the molecular formula C15H20BrNO5S and a molecular weight of 406.30 g/mol. Its IUPAC name is (3R)-1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(1,3-dioxolan-2-yl)piperidine.
| Compound Name | (3R)-1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(1,3-dioxolan-2-yl)piperidine |
|---|---|
| PubChem CID | 95345944 |
| Molecular Formula | C15H20BrNO5S |
| Molecular Weight | 406.30 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | (3R)-1-(3-bromo-4-methoxyphenyl)sulfonyl-3-(1,3-dioxolan-2-yl)piperidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC[C@@H](C3OCCO3)C2)cc1Br |
| InChI | InChI=1S/C15H20BrNO5S/c1-20-14-5-4-12(9-13(14)16)23(18,19)17-6-2-3-11(10-17)15-21-7-8-22-15/h4-5,9,11,15H,2-3,6-8,10H2,1H3/t11-/m1/s1 |
| InChIKey | WGDIOFLHBVFWKX-LLVKDONJSA-N |
| XLogP | 2.23 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |