C17H19BrN2O6S2 — CID 1349058
3-bromo-4-methoxy-N-(4-morpholin-4-ylsulfonylphenyl)benzenesulfonamide (PubChem CID 1349058) has the molecular formula C17H19BrN2O6S2 and a molecular weight of 491.39 g/mol. Its IUPAC name is 3-bromo-4-methoxy-N-(4-morpholin-4-ylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 3-bromo-4-methoxy-N-(4-morpholin-4-ylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 1349058 |
| Molecular Formula | C17H19BrN2O6S2 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | 3-bromo-4-methoxy-N-(4-morpholin-4-ylsulfonylphenyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1Br |
| InChI | InChI=1S/C17H19BrN2O6S2/c1-25-17-7-6-15(12-16(17)18)27(21,22)19-13-2-4-14(5-3-13)28(23,24)20-8-10-26-11-9-20/h2-7,12,19H,8-11H2,1H3 |
| InChIKey | JWDUACFHANDFNR-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |