C25H28N4O7S3 — CID 25035866
1-[2-methoxy-4-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 25035866) has the molecular formula C25H28N4O7S3 and a molecular weight of 592.72 g/mol. Its IUPAC name is 1-[2-methoxy-4-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-[2-methoxy-4-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 25035866 |
| Molecular Formula | C25H28N4O7S3 |
| Molecular Weight | 592.72 g/mol |
| Exact Mass | 592.11 |
| IUPAC Name | 1-[2-methoxy-4-[(2-methoxyphenyl)sulfamoyl]phenyl]-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2OC)ccc1NC(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C25H28N4O7S3/c1-34-23-6-4-3-5-22(23)28-38(30,31)20-11-12-21(24(17-20)35-2)27-25(37)26-18-7-9-19(10-8-18)39(32,33)29-13-15-36-16-14-29/h3-12,17,28H,13-16H2,1-2H3,(H2,26,27,37) |
| InChIKey | ICCIHXUDUNESBP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|