C18H20FN3O3S2 — CID 53489000
1-(4-fluoro-2-methylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 53489000) has the molecular formula C18H20FN3O3S2 and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 53489000 |
| Molecular Formula | C18H20FN3O3S2 |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | Cc1cc(F)ccc1NC(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C18H20FN3O3S2/c1-13-12-14(19)2-7-17(13)21-18(26)20-15-3-5-16(6-4-15)27(23,24)22-8-10-25-11-9-22/h2-7,12H,8-11H2,1H3,(H2,20,21,26) |
| InChIKey | DMLKYUYAXVLHKK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|