C17H17ClN4O5S2 — CID 23828394
1-(5-chloro-2-nitrophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 23828394) has the molecular formula C17H17ClN4O5S2 and a molecular weight of 456.93 g/mol. Its IUPAC name is 1-(5-chloro-2-nitrophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(5-chloro-2-nitrophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 23828394 |
| Molecular Formula | C17H17ClN4O5S2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 1-(5-chloro-2-nitrophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=[N+]([O-])c1ccc(Cl)cc1NC(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1 |
| InChI | InChI=1S/C17H17ClN4O5S2/c18-12-1-6-16(22(23)24)15(11-12)20-17(28)19-13-2-4-14(5-3-13)29(25,26)21-7-9-27-10-8-21/h1-6,11H,7-10H2,(H2,19,20,28) |
| InChIKey | DUGPNWLKAQBQPP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|