C19H21N5O6S2 — CID 5161325
1-(4-acetylphenyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)thiourea (PubChem CID 5161325) has the molecular formula C19H21N5O6S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 1-(4-acetylphenyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)thiourea.
| Compound Name | 1-(4-acetylphenyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)thiourea |
|---|---|
| PubChem CID | 5161325 |
| Molecular Formula | C19H21N5O6S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.09 |
| IUPAC Name | 1-(4-acetylphenyl)-3-(4-morpholin-4-ylsulfonyl-2-nitroanilino)thiourea |
| SMILES | CC(=O)c1ccc(NC(=S)NNc2ccc(S(=O)(=O)N3CCOCC3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21N5O6S2/c1-13(25)14-2-4-15(5-3-14)20-19(31)22-21-17-7-6-16(12-18(17)24(26)27)32(28,29)23-8-10-30-11-9-23/h2-7,12,21H,8-11H2,1H3,(H2,20,22,31) |
| InChIKey | MQRNHEAVINRUAL-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 142.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_urea_D(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|