C19H19N5O5S2 — CID 23738685
1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 23738685) has the molecular formula C19H19N5O5S2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 23738685 |
| Molecular Formula | C19H19N5O5S2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 1-(1,4-dioxo-2,3-dihydrophthalazin-5-yl)-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=c1[nH][nH]c(=O)c2c(NC(=S)Nc3ccc(S(=O)(=O)N4CCOCC4)cc3)cccc12 |
| InChI | InChI=1S/C19H19N5O5S2/c25-17-14-2-1-3-15(16(14)18(26)23-22-17)21-19(30)20-12-4-6-13(7-5-12)31(27,28)24-8-10-29-11-9-24/h1-7H,8-11H2,(H,22,25)(H,23,26)(H2,20,21,30) |
| InChIKey | ZGLLRKOOUJNDNL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 136.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|