C24H23N3O5S2 — CID 2370855
(E)-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 2370855) has the molecular formula C24H23N3O5S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is (E)-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2370855 |
| Molecular Formula | C24H23N3O5S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | (E)-N-[(5-hydroxynaphthalen-1-yl)carbamothioyl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)NC(=S)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C24H23N3O5S2/c28-22-6-2-3-19-20(22)4-1-5-21(19)25-24(33)26-23(29)12-9-17-7-10-18(11-8-17)34(30,31)27-13-15-32-16-14-27/h1-12,28H,13-16H2,(H2,25,26,29,33)/b12-9+ |
| InChIKey | JGGAXXWRTKFMKF-FMIVXFBMSA-N |
| XLogP | 3.09 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|