C19H18F2N2O4S — CID 76859964
N-(2,6-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 76859964) has the molecular formula C19H18F2N2O4S and a molecular weight of 408.43 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | N-(2,6-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 76859964 |
| Molecular Formula | C19H18F2N2O4S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | N-(2,6-difluorophenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C19H18F2N2O4S/c20-16-2-1-3-17(21)19(16)22-18(24)9-6-14-4-7-15(8-5-14)28(25,26)23-10-12-27-13-11-23/h1-9H,10-13H2,(H,22,24) |
| InChIKey | XFQJZVCWVPTBOR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|