C17H23N3O4S2 — CID 2412835
N-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]cyclopentanecarboxamide (PubChem CID 2412835) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]cyclopentanecarboxamide.
| Compound Name | N-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 2412835 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | N-[(4-morpholin-4-ylsulfonylphenyl)carbamothioyl]cyclopentanecarboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)C1CCCC1 |
| InChI | InChI=1S/C17H23N3O4S2/c21-16(13-3-1-2-4-13)19-17(25)18-14-5-7-15(8-6-14)26(22,23)20-9-11-24-12-10-20/h5-8,13H,1-4,9-12H2,(H2,18,19,21,25) |
| InChIKey | SUYMHYKMYUHLFY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|