C17H25N3O3S2 — CID 2210495
1-cyclohexyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea (PubChem CID 2210495) has the molecular formula C17H25N3O3S2 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 2210495 |
| Molecular Formula | C17H25N3O3S2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-cyclohexyl-3-(4-morpholin-4-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)NC2CCCCC2)cc1)N1CCOCC1 |
| InChI | InChI=1S/C17H25N3O3S2/c21-25(22,20-10-12-23-13-11-20)16-8-6-15(7-9-16)19-17(24)18-14-4-2-1-3-5-14/h6-9,14H,1-5,10-13H2,(H2,18,19,24) |
| InChIKey | GHABQOLYAUUUPJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|