C19H29N3O2S2 — CID 27521970
1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea (PubChem CID 27521970) has the molecular formula C19H29N3O2S2 and a molecular weight of 395.59 g/mol. Its IUPAC name is 1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 27521970 |
| Molecular Formula | C19H29N3O2S2 |
| Molecular Weight | 395.59 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-cyclopentyl-3-[4-[(3R,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc(NC(=S)NC3CCCC3)cc2)C1 |
| InChI | InChI=1S/C19H29N3O2S2/c1-14-11-15(2)13-22(12-14)26(23,24)18-9-7-17(8-10-18)21-19(25)20-16-5-3-4-6-16/h7-10,14-16H,3-6,11-13H2,1-2H3,(H2,20,21,25)/t14-,15+ |
| InChIKey | YFFQBJVYWWUTCA-GASCZTMLSA-N |
| XLogP | 3.58 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|