C18H27N3O2S2 — CID 27520917
(3R,5S)-3,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide (PubChem CID 27520917) has the molecular formula C18H27N3O2S2 and a molecular weight of 381.57 g/mol. Its IUPAC name is (3R,5S)-3,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide.
| Compound Name | (3R,5S)-3,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 27520917 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (3R,5S)-3,5-dimethyl-N-(4-pyrrolidin-1-ylsulfonylphenyl)piperidine-1-carbothioamide |
| SMILES | C[C@@H]1C[C@H](C)CN(C(=S)Nc2ccc(S(=O)(=O)N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C18H27N3O2S2/c1-14-11-15(2)13-20(12-14)18(24)19-16-5-7-17(8-6-16)25(22,23)21-9-3-4-10-21/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,19,24)/t14-,15+ |
| InChIKey | GNDLEVXHZIBODF-GASCZTMLSA-N |
| XLogP | 3.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|