C24H33N3O2S2 — CID 29057113
1-(4-butylphenyl)-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea (PubChem CID 29057113) has the molecular formula C24H33N3O2S2 and a molecular weight of 459.68 g/mol. Its IUPAC name is 1-(4-butylphenyl)-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea.
| Compound Name | 1-(4-butylphenyl)-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 29057113 |
| Molecular Formula | C24H33N3O2S2 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-(4-butylphenyl)-3-[4-[(3S,5S)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]thiourea |
| SMILES | CCCCc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3C[C@@H](C)C[C@H](C)C3)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O2S2/c1-4-5-6-20-7-9-21(10-8-20)25-24(30)26-22-11-13-23(14-12-22)31(28,29)27-16-18(2)15-19(3)17-27/h7-14,18-19H,4-6,15-17H2,1-3H3,(H2,25,26,30)/t18-,19-/m0/s1 |
| InChIKey | SYMJIPPVCLRTQE-OALUTQOASA-N |
| XLogP | 5.50 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|