C21H27N3O2S2 — CID 27525387
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methylphenyl)thiourea (PubChem CID 27525387) has the molecular formula C21H27N3O2S2 and a molecular weight of 417.60 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 27525387 |
| Molecular Formula | C21H27N3O2S2 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)Nc1ccc(S(=O)(=O)N2C[C@H](C)C[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C21H27N3O2S2/c1-15-12-16(2)14-24(13-15)28(25,26)19-10-8-18(9-11-19)22-21(27)23-20-7-5-4-6-17(20)3/h4-11,15-16H,12-14H2,1-3H3,(H2,22,23,27)/t15-,16-/m1/s1 |
| InChIKey | IDACFXACXXBDLQ-HZPDHXFCSA-N |
| XLogP | 4.47 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|