C21H24F3N3O2S2 — CID 29056312
1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 29056312) has the molecular formula C21H24F3N3O2S2 and a molecular weight of 471.57 g/mol. Its IUPAC name is 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 29056312 |
| Molecular Formula | C21H24F3N3O2S2 |
| Molecular Weight | 471.57 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | 1-[4-[(3R,5R)-3,5-dimethylpiperidin-1-yl]sulfonylphenyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(S(=O)(=O)c2ccc(NC(=S)Nc3cccc(C(F)(F)F)c3)cc2)C1 |
| InChI | InChI=1S/C21H24F3N3O2S2/c1-14-10-15(2)13-27(12-14)31(28,29)19-8-6-17(7-9-19)25-20(30)26-18-5-3-4-16(11-18)21(22,23)24/h3-9,11,14-15H,10,12-13H2,1-2H3,(H2,25,26,30)/t14-,15-/m1/s1 |
| InChIKey | XQIZLYRQJHJAJS-HUUCEWRRSA-N |
| XLogP | 5.18 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|