C21H27N3O3S2 — CID 17349490
1-[4-(2-hydroxyethyl)phenyl]-3-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]thiourea (PubChem CID 17349490) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)phenyl]-3-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]thiourea.
| Compound Name | 1-[4-(2-hydroxyethyl)phenyl]-3-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]thiourea |
|---|---|
| PubChem CID | 17349490 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)phenyl]-3-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]thiourea |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=S)Nc3ccc(CCO)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H27N3O3S2/c1-16-10-13-24(14-11-16)29(26,27)20-8-6-19(7-9-20)23-21(28)22-18-4-2-17(3-5-18)12-15-25/h2-9,16,25H,10-15H2,1H3,(H2,22,23,28) |
| InChIKey | MSNRFRBWUQONGL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|