C21H24BrN3O4S2 — CID 3346035
2-(4-bromophenoxy)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]acetamide (PubChem CID 3346035) has the molecular formula C21H24BrN3O4S2 and a molecular weight of 526.48 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3346035 |
| Molecular Formula | C21H24BrN3O4S2 |
| Molecular Weight | 526.48 g/mol |
| Exact Mass | 525.04 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]acetamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=S)NC(=O)COc3ccc(Br)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H24BrN3O4S2/c1-15-10-12-25(13-11-15)31(27,28)19-8-4-17(5-9-19)23-21(30)24-20(26)14-29-18-6-2-16(22)3-7-18/h2-9,15H,10-14H2,1H3,(H2,23,24,26,30) |
| InChIKey | KQEGDZQOESMVAF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|