C28H31N3O4S2 — CID 17134649
N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134649) has the molecular formula C28H31N3O4S2 and a molecular weight of 537.71 g/mol. Its IUPAC name is N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134649 |
| Molecular Formula | C28H31N3O4S2 |
| Molecular Weight | 537.71 g/mol |
| Exact Mass | 537.18 |
| IUPAC Name | N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=S)NC(=O)c3cccc(OCCc4ccccc4)c3)cc2)CC1 |
| InChI | InChI=1S/C28H31N3O4S2/c1-21-14-17-31(18-15-21)37(33,34)26-12-10-24(11-13-26)29-28(36)30-27(32)23-8-5-9-25(20-23)35-19-16-22-6-3-2-4-7-22/h2-13,20-21H,14-19H2,1H3,(H2,29,30,32,36) |
| InChIKey | VLLZVPCVRYKBPU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.71 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|