C23H29N3O4S2 — CID 17142671
N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-propan-2-yloxybenzamide (PubChem CID 17142671) has the molecular formula C23H29N3O4S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-propan-2-yloxybenzamide.
| Compound Name | N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 17142671 |
| Molecular Formula | C23H29N3O4S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | N-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]carbamothioyl]-3-propan-2-yloxybenzamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(NC(=S)NC(=O)c3cccc(OC(C)C)c3)cc2)CC1 |
| InChI | InChI=1S/C23H29N3O4S2/c1-16(2)30-20-6-4-5-18(15-20)22(27)25-23(31)24-19-7-9-21(10-8-19)32(28,29)26-13-11-17(3)12-14-26/h4-10,15-17H,11-14H2,1-3H3,(H2,24,25,27,31) |
| InChIKey | CDDUJNUTXXGAIN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|