C17H18ClN3O2S2 — CID 19680441
1-(3-chlorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea (PubChem CID 19680441) has the molecular formula C17H18ClN3O2S2 and a molecular weight of 395.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
|---|---|
| PubChem CID | 19680441 |
| Molecular Formula | C17H18ClN3O2S2 |
| Molecular Weight | 395.94 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(4-pyrrolidin-1-ylsulfonylphenyl)thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)Nc2cccc(Cl)c2)cc1)N1CCCC1 |
| InChI | InChI=1S/C17H18ClN3O2S2/c18-13-4-3-5-15(12-13)20-17(24)19-14-6-8-16(9-7-14)25(22,23)21-10-1-2-11-21/h3-9,12H,1-2,10-11H2,(H2,19,20,24) |
| InChIKey | HDUNYHVEXRPUEP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.94 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|