C20H17Cl2N3O3S2 — CID 19678627
1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 19678627) has the molecular formula C20H17Cl2N3O3S2 and a molecular weight of 482.41 g/mol. Its IUPAC name is 1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 19678627 |
| Molecular Formula | C20H17Cl2N3O3S2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 1-[4-[(3,4-dichlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C20H17Cl2N3O3S2/c1-28-19-5-3-2-4-18(19)24-20(29)23-13-6-9-15(10-7-13)30(26,27)25-14-8-11-16(21)17(22)12-14/h2-12,25H,1H3,(H2,23,24,29) |
| InChIKey | AVLXDVWJLPKKES-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|