C17H21N3O4S2 — CID 19679043
1-(2-methoxyethyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea (PubChem CID 19679043) has the molecular formula C17H21N3O4S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 19679043 |
| Molecular Formula | C17H21N3O4S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 1-(2-methoxyethyl)-3-[4-[(2-methoxyphenyl)sulfamoyl]phenyl]thiourea |
| SMILES | COCCNC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C17H21N3O4S2/c1-23-12-11-18-17(25)19-13-7-9-14(10-8-13)26(21,22)20-15-5-3-4-6-16(15)24-2/h3-10,20H,11-12H2,1-2H3,(H2,18,19,25) |
| InChIKey | WGCYJPHLCMVOQZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|