C16H18ClN3O3S2 — CID 19678582
1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyethyl)thiourea (PubChem CID 19678582) has the molecular formula C16H18ClN3O3S2 and a molecular weight of 399.93 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 19678582 |
| Molecular Formula | C16H18ClN3O3S2 |
| Molecular Weight | 399.93 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)sulfamoyl]phenyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H18ClN3O3S2/c1-23-11-10-18-16(24)19-13-6-8-15(9-7-13)25(21,22)20-14-4-2-12(17)3-5-14/h2-9,20H,10-11H2,1H3,(H2,18,19,24) |
| InChIKey | NUPAQKRXGVLGBO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.93 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|