C12H17ClN2OS — CID 8669388
1-[2-(4-chlorophenyl)ethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 8669388) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)ethyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[2-(4-chlorophenyl)ethyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 8669388 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-[2-(4-chlorophenyl)ethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H17ClN2OS/c1-16-9-8-15-12(17)14-7-6-10-2-4-11(13)5-3-10/h2-5H,6-9H2,1H3,(H2,14,15,17) |
| InChIKey | DVHNEKHVYRLTLO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|