C10H13ClN2O2S — CID 124749200
1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyethyl)thiourea (PubChem CID 124749200) has the molecular formula C10H13ClN2O2S and a molecular weight of 260.75 g/mol. Its IUPAC name is 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 124749200 |
| Molecular Formula | C10H13ClN2O2S |
| Molecular Weight | 260.75 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 1-(5-chloro-2-hydroxyphenyl)-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H13ClN2O2S/c1-15-5-4-12-10(16)13-8-6-7(11)2-3-9(8)14/h2-3,6,14H,4-5H2,1H3,(H2,12,13,16) |
| InChIKey | RNDVTJLUURZPHF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.75 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|