C9H12ClN3OS — CID 19686299
1-(5-chloro-2-pyridinyl)-3-(2-methoxyethyl)thiourea (PubChem CID 19686299) has the molecular formula C9H12ClN3OS and a molecular weight of 245.73 g/mol. Its IUPAC name is 1-(5-chloro-2-pyridinyl)-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-(5-chloro-2-pyridinyl)-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 19686299 |
| Molecular Formula | C9H12ClN3OS |
| Molecular Weight | 245.73 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 1-(5-chloro-2-pyridinyl)-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C9H12ClN3OS/c1-14-5-4-11-9(15)13-8-3-2-7(10)6-12-8/h2-3,6H,4-5H2,1H3,(H2,11,12,13,15) |
| InChIKey | CQKDAZIFXUQANI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.73 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|